About tert-butyl-dimethyl-[(2E,4Z)-4-methylundeca-2,4-dienoxy]silane
tert-butyl-dimethyl-[(2E,4Z)-4-methylundeca-2,4-dienoxy]silane (PubChem CID 101267051) has the molecular formula C18H36OSi
and a molecular weight of 296.57 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2E,4Z)-4-methylundeca-2,4-dienoxy]silane.
Molecular Properties
| Compound Name | tert-butyl-dimethyl-[(2E,4Z)-4-methylundeca-2,4-dienoxy]silane |
| PubChem CID | 101267051 |
| Molecular Formula | C18H36OSi |
| Molecular Weight | 296.57 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | tert-butyl-dimethyl-[(2E,4Z)-4-methylundeca-2,4-dienoxy]silane |
| SMILES | CCCCCC/C=C(C)\C=C\CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36OSi/c1-8-9-10-11-12-14-17(2)15-13-16-19-20(6,7)18(3,4)5/h13-15H,8-12,16H2,1-7H3/b15-13+,17-14- |
| InChIKey | UVIZHWPCVIWDGS-FBWUVJDOSA-N |
| XLogP | 6.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.57 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-dimethyl-[(2E,4Z)-4-methylundeca-2,4-dienoxy]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-dimethyl-[(2E,4Z)-4-methylundeca-2,4-dienoxy]silane?
The IUPAC name of tert-butyl-dimethyl-[(2E,4Z)-4-methylundeca-2,4-dienoxy]silane (CID 101267051) is tert-butyl-dimethyl-[(2E,4Z)-4-methylundeca-2,4-dienoxy]silane.
What is the SMILES notation for tert-butyl-dimethyl-[(2E,4Z)-4-methylundeca-2,4-dienoxy]silane?
The canonical SMILES for tert-butyl-dimethyl-[(2E,4Z)-4-methylundeca-2,4-dienoxy]silane is CCCCCC/C=C(C)\C=C\CO[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl-dimethyl-[(2E,4Z)-4-methylundeca-2,4-dienoxy]silane?
The InChIKey is UVIZHWPCVIWDGS-FBWUVJDOSA-N. The full InChI is InChI=1S/C18H36OSi/c1-8-9-10-11-12-14-17(2)15-13-16-19-20(6,7)18(3,4)5/h13-15H,8-12,16H2,1-7H3/b15-13+,17-14-.
What are the key properties of tert-butyl-dimethyl-[(2E,4Z)-4-methylundeca-2,4-dienoxy]silane?
tert-butyl-dimethyl-[(2E,4Z)-4-methylundeca-2,4-dienoxy]silane has a molecular weight of 296.57 g/mol, XLogP of 6.48, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-dimethyl-[(2E,4Z)-4-methylundeca-2,4-dienoxy]silane is sourced from PubChem (CID 101267051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).