C28H31NO8 — CID 101267128
(1R,2S,3R,4R,5R,6R)-6-nitro-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)cyclohexane-1,2,4-triol (PubChem CID 101267128) has the molecular formula C28H31NO8 and a molecular weight of 509.56 g/mol. Its IUPAC name is (1R,2S,3R,4R,5R,6R)-6-nitro-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)cyclohexane-1,2,4-triol.
| Compound Name | (1R,2S,3R,4R,5R,6R)-6-nitro-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)cyclohexane-1,2,4-triol |
|---|---|
| PubChem CID | 101267128 |
| Molecular Formula | C28H31NO8 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | (1R,2S,3R,4R,5R,6R)-6-nitro-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)cyclohexane-1,2,4-triol |
| SMILES | O=[N+]([O-])[C@@]1(COCc2ccccc2)[C@@H](OCc2ccccc2)C(O)[C@H](OCc2ccccc2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C28H31NO8/c30-23-25(36-17-21-12-6-2-7-13-21)24(31)27(37-18-22-14-8-3-9-15-22)28(26(23)32,29(33)34)19-35-16-20-10-4-1-5-11-20/h1-15,23-27,30-32H,16-19H2/t23-,24?,25-,26+,27+,28-/m1/s1 |
| InChIKey | OGXZXEXXTONACC-XWPCCVGGSA-N |
| XLogP | 2.49 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|