C37H52O5Si — CID 101267151
tert-butyl (3R,5S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-3,5-dimethyl-6-(phenylmethoxymethoxy)heptanoate (PubChem CID 101267151) has the molecular formula C37H52O5Si and a molecular weight of 604.90 g/mol. Its IUPAC name is tert-butyl (3R,5S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-3,5-dimethyl-6-(phenylmethoxymethoxy)heptanoate.
| Compound Name | tert-butyl (3R,5S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-3,5-dimethyl-6-(phenylmethoxymethoxy)heptanoate |
|---|---|
| PubChem CID | 101267151 |
| Molecular Formula | C37H52O5Si |
| Molecular Weight | 604.90 g/mol |
| Exact Mass | 604.36 |
| IUPAC Name | tert-butyl (3R,5S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-3,5-dimethyl-6-(phenylmethoxymethoxy)heptanoate |
| SMILES | C[C@@H](CC(=O)OC(C)(C)C)C[C@H](C)[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OCOCc1ccccc1 |
| InChI | InChI=1S/C37H52O5Si/c1-29(25-35(38)42-36(3,4)5)24-30(2)34(40-28-39-26-31-18-12-9-13-19-31)27-41-43(37(6,7)8,32-20-14-10-15-21-32)33-22-16-11-17-23-33/h9-23,29-30,34H,24-28H2,1-8H3/t29-,30+,34-/m1/s1 |
| InChIKey | FOSCKRJDSQMDLR-LMGJUQTBSA-N |
| XLogP | 7.52 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.90 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|