C5Cl2F8O — CID 101267346
3,5-dichloro-1,1,1,3,4,4,5,5-octafluoropentan-2-one (PubChem CID 101267346) has the molecular formula C5Cl2F8O and a molecular weight of 298.94 g/mol. Its IUPAC name is 3,5-dichloro-1,1,1,3,4,4,5,5-octafluoropentan-2-one.
| Compound Name | 3,5-dichloro-1,1,1,3,4,4,5,5-octafluoropentan-2-one |
|---|---|
| PubChem CID | 101267346 |
| Molecular Formula | C5Cl2F8O |
| Molecular Weight | 298.94 g/mol |
| Exact Mass | 297.92 |
| IUPAC Name | 3,5-dichloro-1,1,1,3,4,4,5,5-octafluoropentan-2-one |
| SMILES | O=C(C(F)(F)F)C(F)(Cl)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C5Cl2F8O/c6-2(8,1(16)3(9,10)11)4(12,13)5(7,14)15 |
| InChIKey | WWKWMYADZDJGPE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.94 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|