C23H37NO3Si — CID 101267405
2-[(2S,3S,4S,5S)-1-hydroxy-3,4-bis[(2-methylpropan-2-yl)oxy]-5-phenylpyrrolidin-2-yl]ethynyl-trimethylsilane (PubChem CID 101267405) has the molecular formula C23H37NO3Si and a molecular weight of 403.64 g/mol. Its IUPAC name is 2-[(2S,3S,4S,5S)-1-hydroxy-3,4-bis[(2-methylpropan-2-yl)oxy]-5-phenylpyrrolidin-2-yl]ethynyl-trimethylsilane.
| Compound Name | 2-[(2S,3S,4S,5S)-1-hydroxy-3,4-bis[(2-methylpropan-2-yl)oxy]-5-phenylpyrrolidin-2-yl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 101267405 |
| Molecular Formula | C23H37NO3Si |
| Molecular Weight | 403.64 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | 2-[(2S,3S,4S,5S)-1-hydroxy-3,4-bis[(2-methylpropan-2-yl)oxy]-5-phenylpyrrolidin-2-yl]ethynyl-trimethylsilane |
| SMILES | CC(C)(C)O[C@@H]1[C@@H](OC(C)(C)C)[C@H](c2ccccc2)N(O)[C@H]1C#C[Si](C)(C)C |
| InChI | InChI=1S/C23H37NO3Si/c1-22(2,3)26-20-18(15-16-28(7,8)9)24(25)19(17-13-11-10-12-14-17)21(20)27-23(4,5)6/h10-14,18-21,25H,1-9H3/t18-,19-,20-,21-/m0/s1 |
| InChIKey | OUHNGUZNPHYASM-TUFLPTIASA-N |
| XLogP | 5.05 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.64 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|