C35H48O6SSi2 — CID 101267917
[(2R,3S)-2-[[(2R,3S)-2-(benzenesulfonyl)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]oxiran-2-yl]methyl]-3-methyloxan-3-yl]oxy-trimethylsilane (PubChem CID 101267917) has the molecular formula C35H48O6SSi2 and a molecular weight of 653.00 g/mol. Its IUPAC name is [(2R,3S)-2-[[(2R,3S)-2-(benzenesulfonyl)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]oxiran-2-yl]methyl]-3-methyloxan-3-yl]oxy-trimethylsilane.
| Compound Name | [(2R,3S)-2-[[(2R,3S)-2-(benzenesulfonyl)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]oxiran-2-yl]methyl]-3-methyloxan-3-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 101267917 |
| Molecular Formula | C35H48O6SSi2 |
| Molecular Weight | 653.00 g/mol |
| Exact Mass | 652.27 |
| IUPAC Name | [(2R,3S)-2-[[(2R,3S)-2-(benzenesulfonyl)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]oxiran-2-yl]methyl]-3-methyloxan-3-yl]oxy-trimethylsilane |
| SMILES | CC(C)(C)[Si](OC[C@@H]1O[C@]1(C[C@H]1OCCC[C@]1(C)O[Si](C)(C)C)S(=O)(=O)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H48O6SSi2/c1-33(2,3)44(29-20-13-9-14-21-29,30-22-15-10-16-23-30)39-27-32-35(40-32,42(36,37)28-18-11-8-12-19-28)26-31-34(4,24-17-25-38-31)41-43(5,6)7/h8-16,18-23,31-32H,17,24-27H2,1-7H3/t31-,32+,34+,35-/m1/s1 |
| InChIKey | RVJALJHIPQDVDH-LWNMIYKMSA-N |
| XLogP | 6.31 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.00 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|