C20H40O2Si — CID 101267950
(2S)-2-methyl-2-[(E,2S)-4-tri(propan-2-yl)silyloxybut-3-en-2-yl]hexanal (PubChem CID 101267950) has the molecular formula C20H40O2Si and a molecular weight of 340.62 g/mol. Its IUPAC name is (2S)-2-methyl-2-[(E,2S)-4-tri(propan-2-yl)silyloxybut-3-en-2-yl]hexanal.
| Compound Name | (2S)-2-methyl-2-[(E,2S)-4-tri(propan-2-yl)silyloxybut-3-en-2-yl]hexanal |
|---|---|
| PubChem CID | 101267950 |
| Molecular Formula | C20H40O2Si |
| Molecular Weight | 340.62 g/mol |
| Exact Mass | 340.28 |
| IUPAC Name | (2S)-2-methyl-2-[(E,2S)-4-tri(propan-2-yl)silyloxybut-3-en-2-yl]hexanal |
| SMILES | CCCC[C@](C)(C=O)[C@@H](C)/C=C/O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H40O2Si/c1-10-11-13-20(9,15-21)19(8)12-14-22-23(16(2)3,17(4)5)18(6)7/h12,14-19H,10-11,13H2,1-9H3/b14-12+/t19-,20+/m0/s1 |
| InChIKey | FNYODPHXTXRUKD-NJDMILDMSA-N |
| XLogP | 6.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.62 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|