About cis-benzyl (1R,2S)-2-(phenylmethoxycarbonylamino)cyclobutane-1-carboxylate
cis-benzyl (1R,2S)-2-(phenylmethoxycarbonylamino)cyclobutane-1-carboxylate (PubChem CID 101268070) has the molecular formula C20H21NO4
and a molecular weight of 339.39 g/mol. Its IUPAC name is cis-benzyl (1R,2S)-2-(phenylmethoxycarbonylamino)cyclobutane-1-carboxylate.
Molecular Properties
| Compound Name | cis-benzyl (1R,2S)-2-(phenylmethoxycarbonylamino)cyclobutane-1-carboxylate |
| PubChem CID | 101268070 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | cis-benzyl (1R,2S)-2-(phenylmethoxycarbonylamino)cyclobutane-1-carboxylate |
| SMILES | O=C(N[C@H]1CC[C@H]1C(=O)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C20H21NO4/c22-19(24-13-15-7-3-1-4-8-15)17-11-12-18(17)21-20(23)25-14-16-9-5-2-6-10-16/h1-10,17-18H,11-14H2,(H,21,23)/t17-,18+/m1/s1 |
| InChIKey | FRFINJWREHLVOM-MSOLQXFVSA-N |
| XLogP | 3.43 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cis-benzyl (1R,2S)-2-(phenylmethoxycarbonylamino)cyclobutane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-benzyl (1R,2S)-2-(phenylmethoxycarbonylamino)cyclobutane-1-carboxylate?
The IUPAC name of cis-benzyl (1R,2S)-2-(phenylmethoxycarbonylamino)cyclobutane-1-carboxylate (CID 101268070) is cis-benzyl (1R,2S)-2-(phenylmethoxycarbonylamino)cyclobutane-1-carboxylate.
What is the SMILES notation for cis-benzyl (1R,2S)-2-(phenylmethoxycarbonylamino)cyclobutane-1-carboxylate?
The canonical SMILES for cis-benzyl (1R,2S)-2-(phenylmethoxycarbonylamino)cyclobutane-1-carboxylate is O=C(N[C@H]1CC[C@H]1C(=O)OCc1ccccc1)OCc1ccccc1.
What is the InChIKey of cis-benzyl (1R,2S)-2-(phenylmethoxycarbonylamino)cyclobutane-1-carboxylate?
The InChIKey is FRFINJWREHLVOM-MSOLQXFVSA-N. The full InChI is InChI=1S/C20H21NO4/c22-19(24-13-15-7-3-1-4-8-15)17-11-12-18(17)21-20(23)25-14-16-9-5-2-6-10-16/h1-10,17-18H,11-14H2,(H,21,23)/t17-,18+/m1/s1.
What are the key properties of cis-benzyl (1R,2S)-2-(phenylmethoxycarbonylamino)cyclobutane-1-carboxylate?
cis-benzyl (1R,2S)-2-(phenylmethoxycarbonylamino)cyclobutane-1-carboxylate has a molecular weight of 339.39 g/mol, XLogP of 3.43, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cis-benzyl (1R,2S)-2-(phenylmethoxycarbonylamino)cyclobutane-1-carboxylate is sourced from PubChem (CID 101268070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).