C17H22O4 — CID 101268343
dimethyl (3aS,8aS)-3-prop-1-en-2-yl-6,7,8,8a-tetrahydro-3aH-azulene-1,1-dicarboxylate (PubChem CID 101268343) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is dimethyl (3aS,8aS)-3-prop-1-en-2-yl-6,7,8,8a-tetrahydro-3aH-azulene-1,1-dicarboxylate.
| Compound Name | dimethyl (3aS,8aS)-3-prop-1-en-2-yl-6,7,8,8a-tetrahydro-3aH-azulene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 101268343 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | dimethyl (3aS,8aS)-3-prop-1-en-2-yl-6,7,8,8a-tetrahydro-3aH-azulene-1,1-dicarboxylate |
| SMILES | C=C(C)C1=CC(C(=O)OC)(C(=O)OC)[C@H]2CCCC=C[C@H]12 |
| InChI | InChI=1S/C17H22O4/c1-11(2)13-10-17(15(18)20-3,16(19)21-4)14-9-7-5-6-8-12(13)14/h6,8,10,12,14H,1,5,7,9H2,2-4H3/t12-,14+/m1/s1 |
| InChIKey | QHYVKJGSELTCHJ-OCCSQVGLSA-N |
| XLogP | 2.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|