About CID 101268416
CID 101268416 (PubChem CID 101268416) has the molecular formula C84H64N8O10
and a molecular weight of 1345.48 g/mol.
Molecular Properties
| Compound Name | CID 101268416 |
| PubChem CID | 101268416 |
| Molecular Formula | C84H64N8O10 |
| Molecular Weight | 1345.48 g/mol |
| Exact Mass | 1344.47 |
| IUPAC Name | — |
| SMILES | O=C1N2Cc3cc4c5cc3CN1C1(c3ccccc3)N3Cc6cc7c(cc6CN(C3=O)C21c1ccccc1)OCCOc1ccccc1-c1c2nc(c(c3ccc([nH]3)c(c3nc(c(c6ccc1[nH]6)-c1ccccc1OCCO5)C=C3)-c1ccccc1OCCO4)-c1ccccc1OCCO7)C=C2 |
| InChI | InChI=1S/C84H64N8O10/c93-81-89-47-51-43-73-75-45-53(51)49-91(81)84(56-17-5-2-6-18-56)83(89,55-15-3-1-4-16-55)90-48-52-44-74-76(46-54(52)50-92(84)82(90)94)102-42-38-98-72-26-14-10-22-60(72)80-64-30-28-62(86-64)78(58-20-8-12-24-70(58)96-36-40-100-74)66-32-34-68(88-66)79(59-21-9-13-25-71(59)97-37-41-101-75)63-29-27-61(85-63)77(65-31-33-67(80)87-65)57-19-7-11-23-69(57)95-35-39-99-73/h1-34,43-46,87-88H,35-42,47-50H2/b77-61+,77-65-,78-62+,78-66+,79-63+,79-68+,80-64+,80-67+ |
| InChIKey | RZWNJYMRUQMYBB-UKDWJQEMSA-N |
| XLogP | 16.00 |
| TPSA | 178.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 102 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1345.48 |
| LogP ≤ 5 | 16.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
Analyze CID 101268416 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101268416?
The IUPAC name of CID 101268416 (CID 101268416) is not available.
What is the SMILES notation for CID 101268416?
The canonical SMILES for CID 101268416 is O=C1N2Cc3cc4c5cc3CN1C1(c3ccccc3)N3Cc6cc7c(cc6CN(C3=O)C21c1ccccc1)OCCOc1ccccc1-c1c2nc(c(c3ccc([nH]3)c(c3nc(c(c6ccc1[nH]6)-c1ccccc1OCCO5)C=C3)-c1ccccc1OCCO4)-c1ccccc1OCCO7)C=C2.
What is the InChIKey of CID 101268416?
The InChIKey is RZWNJYMRUQMYBB-UKDWJQEMSA-N. The full InChI is InChI=1S/C84H64N8O10/c93-81-89-47-51-43-73-75-45-53(51)49-91(81)84(56-17-5-2-6-18-56)83(89,55-15-3-1-4-16-55)90-48-52-44-74-76(46-54(52)50-92(84)82(90)94)102-42-38-98-72-26-14-10-22-60(72)80-64-30-28-62(86-64)78(58-20-8-12-24-70(58)96-36-40-100-74)66-32-34-68(88-66)79(59-21-9-13-25-71(59)97-37-41-101-75)63-29-27-61(85-63)77(65-31-33-67(80)87-65)57-19-7-11-23-69(57)95-35-39-99-73/h1-34,43-46,87-88H,35-42,47-50H2/b77-61+,77-65-,78-62+,78-66+,79-63+,79-68+,80-64+,80-67+.
What are the key properties of CID 101268416?
CID 101268416 has a molecular weight of 1345.48 g/mol, XLogP of 16.00, 2 rotatable bonds, 2 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101268416 is sourced from PubChem (CID 101268416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).