C20H38O3Si — CID 101269182
(1R,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-1-(cyclohexen-1-yl)-1-hydroxy-4-methylheptan-3-one (PubChem CID 101269182) has the molecular formula C20H38O3Si and a molecular weight of 354.61 g/mol. Its IUPAC name is (1R,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-1-(cyclohexen-1-yl)-1-hydroxy-4-methylheptan-3-one.
| Compound Name | (1R,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-1-(cyclohexen-1-yl)-1-hydroxy-4-methylheptan-3-one |
|---|---|
| PubChem CID | 101269182 |
| Molecular Formula | C20H38O3Si |
| Molecular Weight | 354.61 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | (1R,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-1-(cyclohexen-1-yl)-1-hydroxy-4-methylheptan-3-one |
| SMILES | CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)C[C@@H](O)C1=CCCCC1 |
| InChI | InChI=1S/C20H38O3Si/c1-8-19(23-24(6,7)20(3,4)5)15(2)17(21)14-18(22)16-12-10-9-11-13-16/h12,15,18-19,22H,8-11,13-14H2,1-7H3/t15-,18+,19-/m0/s1 |
| InChIKey | CPUJATFTAYLZOP-IPELMVKDSA-N |
| XLogP | 5.24 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.61 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|