C28H38Cl3NO6Si — CID 101269253
N-[(2S,3R,4R,5S,6R)-2-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]-2,2,2-trichloroacetamide (PubChem CID 101269253) has the molecular formula C28H38Cl3NO6Si and a molecular weight of 619.06 g/mol. Its IUPAC name is N-[(2S,3R,4R,5S,6R)-2-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]-2,2,2-trichloroacetamide.
| Compound Name | N-[(2S,3R,4R,5S,6R)-2-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 101269253 |
| Molecular Formula | C28H38Cl3NO6Si |
| Molecular Weight | 619.06 g/mol |
| Exact Mass | 617.15 |
| IUPAC Name | N-[(2S,3R,4R,5S,6R)-2-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]-2,2,2-trichloroacetamide |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1O[C@H](COCc2ccccc2)[C@@H](O)[C@H](OCc2ccccc2)[C@H]1NC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C28H38Cl3NO6Si/c1-27(2,3)39(4,5)38-25-22(32-26(34)28(29,30)31)24(36-17-20-14-10-7-11-15-20)23(33)21(37-25)18-35-16-19-12-8-6-9-13-19/h6-15,21-25,33H,16-18H2,1-5H3,(H,32,34)/t21-,22-,23-,24-,25+/m1/s1 |
| InChIKey | XQXJBMGSNQGHAS-JYSSUKAJSA-N |
| XLogP | 5.75 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.06 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|