About ethyl (2S,3R)-3-[fluoro(diphenyl)silyl]-2,4-dimethylpentanoate
ethyl (2S,3R)-3-[fluoro(diphenyl)silyl]-2,4-dimethylpentanoate (PubChem CID 101269308) has the molecular formula C21H27FO2Si
and a molecular weight of 358.53 g/mol. Its IUPAC name is ethyl (2S,3R)-3-[fluoro(diphenyl)silyl]-2,4-dimethylpentanoate.
Molecular Properties
| Compound Name | ethyl (2S,3R)-3-[fluoro(diphenyl)silyl]-2,4-dimethylpentanoate |
| PubChem CID | 101269308 |
| Molecular Formula | C21H27FO2Si |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | ethyl (2S,3R)-3-[fluoro(diphenyl)silyl]-2,4-dimethylpentanoate |
| SMILES | CCOC(=O)[C@H](C)[C@@H](C(C)C)[Si](F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H27FO2Si/c1-5-24-21(23)17(4)20(16(2)3)25(22,18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-17,20H,5H2,1-4H3/t17-,20-/m1/s1 |
| InChIKey | HXWBDTRRSHGXLG-YLJYHZDGSA-N |
| XLogP | 3.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2S,3R)-3-[fluoro(diphenyl)silyl]-2,4-dimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2S,3R)-3-[fluoro(diphenyl)silyl]-2,4-dimethylpentanoate?
The IUPAC name of ethyl (2S,3R)-3-[fluoro(diphenyl)silyl]-2,4-dimethylpentanoate (CID 101269308) is ethyl (2S,3R)-3-[fluoro(diphenyl)silyl]-2,4-dimethylpentanoate.
What is the SMILES notation for ethyl (2S,3R)-3-[fluoro(diphenyl)silyl]-2,4-dimethylpentanoate?
The canonical SMILES for ethyl (2S,3R)-3-[fluoro(diphenyl)silyl]-2,4-dimethylpentanoate is CCOC(=O)[C@H](C)[C@@H](C(C)C)[Si](F)(c1ccccc1)c1ccccc1.
What is the InChIKey of ethyl (2S,3R)-3-[fluoro(diphenyl)silyl]-2,4-dimethylpentanoate?
The InChIKey is HXWBDTRRSHGXLG-YLJYHZDGSA-N. The full InChI is InChI=1S/C21H27FO2Si/c1-5-24-21(23)17(4)20(16(2)3)25(22,18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-17,20H,5H2,1-4H3/t17-,20-/m1/s1.
What are the key properties of ethyl (2S,3R)-3-[fluoro(diphenyl)silyl]-2,4-dimethylpentanoate?
ethyl (2S,3R)-3-[fluoro(diphenyl)silyl]-2,4-dimethylpentanoate has a molecular weight of 358.53 g/mol, XLogP of 3.94, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2S,3R)-3-[fluoro(diphenyl)silyl]-2,4-dimethylpentanoate is sourced from PubChem (CID 101269308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).