C15H22N6O6S — CID 10126955
[(2R,3S,4R,5R)-5-(5,7-diamino-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate (PubChem CID 10126955) has the molecular formula C15H22N6O6S and a molecular weight of 414.44 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(5,7-diamino-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate.
| Compound Name | [(2R,3S,4R,5R)-5-(5,7-diamino-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 10126955 |
| Molecular Formula | C15H22N6O6S |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(5,7-diamino-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate |
| SMILES | CC(C)[C@H](N)C(=O)OC[C@H]1O[C@@H](n2c(=O)sc3c(N)nc(N)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H22N6O6S/c1-4(2)6(16)13(24)26-3-5-7(22)8(23)12(27-5)21-11-9(28-15(21)25)10(17)19-14(18)20-11/h4-8,12,22-23H,3,16H2,1-2H3,(H4,17,18,19,20)/t5-,6+,7-,8-,12-/m1/s1 |
| InChIKey | UUWPPFJHFYSWNA-JKOSFCEQSA-N |
| XLogP | -1.84 |
| TPSA | 201.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |