C24H46O6Si2 — CID 101270026
ethyl (1R,6R,7R)-9,9-ditert-butyl-6-[tert-butyl(dimethyl)silyl]oxy-2,8,10-trioxa-9-silatricyclo[5.4.0.03,5]undecane-4-carboxylate (PubChem CID 101270026) has the molecular formula C24H46O6Si2 and a molecular weight of 486.80 g/mol. Its IUPAC name is ethyl (1R,6R,7R)-9,9-ditert-butyl-6-[tert-butyl(dimethyl)silyl]oxy-2,8,10-trioxa-9-silatricyclo[5.4.0.03,5]undecane-4-carboxylate.
| Compound Name | ethyl (1R,6R,7R)-9,9-ditert-butyl-6-[tert-butyl(dimethyl)silyl]oxy-2,8,10-trioxa-9-silatricyclo[5.4.0.03,5]undecane-4-carboxylate |
|---|---|
| PubChem CID | 101270026 |
| Molecular Formula | C24H46O6Si2 |
| Molecular Weight | 486.80 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | ethyl (1R,6R,7R)-9,9-ditert-butyl-6-[tert-butyl(dimethyl)silyl]oxy-2,8,10-trioxa-9-silatricyclo[5.4.0.03,5]undecane-4-carboxylate |
| SMILES | CCOC(=O)C1C2O[C@@H]3CO[Si](C(C)(C)C)(C(C)(C)C)O[C@H]3[C@H](O[Si](C)(C)C(C)(C)C)C21 |
| InChI | InChI=1S/C24H46O6Si2/c1-13-26-21(25)17-16-19(17)28-15-14-27-32(23(5,6)7,24(8,9)10)30-18(15)20(16)29-31(11,12)22(2,3)4/h15-20H,13-14H2,1-12H3/t15-,16?,17?,18-,19?,20-/m1/s1 |
| InChIKey | DGSXETHRHUUJJW-RHKJPJSFSA-N |
| XLogP | 5.41 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.80 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|