C20H26O6 — CID 101270428
[(S)-[(1R,6S)-2-formyl-1,6-dimethylcyclohex-2-en-1-yl]-[(2R)-2-hydroxy-4-methyl-5-oxo-2H-furan-3-yl]methyl] 3-methylbut-2-enoate (PubChem CID 101270428) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is [(S)-[(1R,6S)-2-formyl-1,6-dimethylcyclohex-2-en-1-yl]-[(2R)-2-hydroxy-4-methyl-5-oxo-2H-furan-3-yl]methyl] 3-methylbut-2-enoate.
| Compound Name | [(S)-[(1R,6S)-2-formyl-1,6-dimethylcyclohex-2-en-1-yl]-[(2R)-2-hydroxy-4-methyl-5-oxo-2H-furan-3-yl]methyl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 101270428 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | [(S)-[(1R,6S)-2-formyl-1,6-dimethylcyclohex-2-en-1-yl]-[(2R)-2-hydroxy-4-methyl-5-oxo-2H-furan-3-yl]methyl] 3-methylbut-2-enoate |
| SMILES | CC(C)=CC(=O)O[C@H](C1=C(C)C(=O)O[C@H]1O)[C@@]1(C)C(C=O)=CCC[C@@H]1C |
| InChI | InChI=1S/C20H26O6/c1-11(2)9-15(22)25-17(16-13(4)18(23)26-19(16)24)20(5)12(3)7-6-8-14(20)10-21/h8-10,12,17,19,24H,6-7H2,1-5H3/t12-,17+,19+,20+/m0/s1 |
| InChIKey | GHEHIUGBJVPRED-YYTAETEZSA-N |
| XLogP | 2.62 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|