C21H30O5 — CID 101270563
(1S,1'S,3aS,4R,6'S,7aR,9'R,10'R)-1-methoxy-7a,10'-dimethylspiro[1,3,3a,5,6,7-hexahydro-2-benzofuran-4,5'-3-oxatricyclo[7.2.1.01,6]dodecane]-2',11'-dione (PubChem CID 101270563) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is (1S,1'S,3aS,4R,6'S,7aR,9'R,10'R)-1-methoxy-7a,10'-dimethylspiro[1,3,3a,5,6,7-hexahydro-2-benzofuran-4,5'-3-oxatricyclo[7.2.1.01,6]dodecane]-2',11'-dione.
| Compound Name | (1S,1'S,3aS,4R,6'S,7aR,9'R,10'R)-1-methoxy-7a,10'-dimethylspiro[1,3,3a,5,6,7-hexahydro-2-benzofuran-4,5'-3-oxatricyclo[7.2.1.01,6]dodecane]-2',11'-dione |
|---|---|
| PubChem CID | 101270563 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | (1S,1'S,3aS,4R,6'S,7aR,9'R,10'R)-1-methoxy-7a,10'-dimethylspiro[1,3,3a,5,6,7-hexahydro-2-benzofuran-4,5'-3-oxatricyclo[7.2.1.01,6]dodecane]-2',11'-dione |
| SMILES | CO[C@H]1OC[C@@H]2[C@@]1(C)CCC[C@]21COC(=O)[C@@]23C[C@@H](CC[C@H]21)[C@@H](C)C3=O |
| InChI | InChI=1S/C21H30O5/c1-12-13-5-6-14-20(11-26-17(23)21(14,9-13)16(12)22)8-4-7-19(2)15(20)10-25-18(19)24-3/h12-15,18H,4-11H2,1-3H3/t12-,13-,14+,15-,18+,19-,20-,21+/m1/s1 |
| InChIKey | WEMXUFWKWPYONE-ZKUZCIJMSA-N |
| XLogP | 2.96 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|