C20H26O5S — CID 101270794
(1'S,5'R,8'S,9'R)-8'-(4-methylphenyl)sulfonylspiro[1,3-dioxolane-2,10'-12-oxatricyclo[7.2.1.01,5]dodecane] (PubChem CID 101270794) has the molecular formula C20H26O5S and a molecular weight of 378.49 g/mol. Its IUPAC name is (1'S,5'R,8'S,9'R)-8'-(4-methylphenyl)sulfonylspiro[1,3-dioxolane-2,10'-12-oxatricyclo[7.2.1.01,5]dodecane].
| Compound Name | (1'S,5'R,8'S,9'R)-8'-(4-methylphenyl)sulfonylspiro[1,3-dioxolane-2,10'-12-oxatricyclo[7.2.1.01,5]dodecane] |
|---|---|
| PubChem CID | 101270794 |
| Molecular Formula | C20H26O5S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | (1'S,5'R,8'S,9'R)-8'-(4-methylphenyl)sulfonylspiro[1,3-dioxolane-2,10'-12-oxatricyclo[7.2.1.01,5]dodecane] |
| SMILES | Cc1ccc(S(=O)(=O)[C@H]2CC[C@H]3CCC[C@]34CC3(OCCO3)[C@H]2O4)cc1 |
| InChI | InChI=1S/C20H26O5S/c1-14-4-7-16(8-5-14)26(21,22)17-9-6-15-3-2-10-19(15)13-20(18(17)25-19)23-11-12-24-20/h4-5,7-8,15,17-18H,2-3,6,9-13H2,1H3/t15-,17+,18+,19+/m1/s1 |
| InChIKey | FRWHJTXKHDTSKX-BVBHFADKSA-N |
| XLogP | 3.00 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |