C13H22O6 — CID 101271103
methyl (2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-2-prop-2-enyl-1,4-dioxane-2-carboxylate (PubChem CID 101271103) has the molecular formula C13H22O6 and a molecular weight of 274.31 g/mol. Its IUPAC name is methyl (2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-2-prop-2-enyl-1,4-dioxane-2-carboxylate.
| Compound Name | methyl (2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-2-prop-2-enyl-1,4-dioxane-2-carboxylate |
|---|---|
| PubChem CID | 101271103 |
| Molecular Formula | C13H22O6 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | methyl (2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-2-prop-2-enyl-1,4-dioxane-2-carboxylate |
| SMILES | C=CC[C@@]1(C(=O)OC)CO[C@@](C)(OC)[C@](C)(OC)O1 |
| InChI | InChI=1S/C13H22O6/c1-7-8-13(10(14)15-4)9-18-11(2,16-5)12(3,17-6)19-13/h7H,1,8-9H2,2-6H3/t11-,12-,13+/m1/s1 |
| InChIKey | JATRWLSTGKUJDS-UPJWGTAASA-N |
| XLogP | 1.25 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|