C14H24N2O7 — CID 101271395
(2S)-2-[[(1S)-1-carboxy-3-methylbutyl]carbamoyloxycarbonylamino]-4-methylpentanoic acid (PubChem CID 101271395) has the molecular formula C14H24N2O7 and a molecular weight of 332.35 g/mol. Its IUPAC name is (2S)-2-[[(1S)-1-carboxy-3-methylbutyl]carbamoyloxycarbonylamino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[(1S)-1-carboxy-3-methylbutyl]carbamoyloxycarbonylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 101271395 |
| Molecular Formula | C14H24N2O7 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | (2S)-2-[[(1S)-1-carboxy-3-methylbutyl]carbamoyloxycarbonylamino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)OC(=O)N[C@@H](CC(C)C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H24N2O7/c1-7(2)5-9(11(17)18)15-13(21)23-14(22)16-10(12(19)20)6-8(3)4/h7-10H,5-6H2,1-4H3,(H,15,21)(H,16,22)(H,17,18)(H,19,20)/t9-,10-/m0/s1 |
| InChIKey | HYBXAUJFQLZPGU-UWVGGRQHSA-N |
| XLogP | 1.42 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|