C60H58O6 — CID 101271686
1-methoxy-4-[(1S,2S)-2-[2-[(1S,2S)-2-[2-[(1S,2S)-2-(4-methoxyphenyl)-1,2-diphenylethoxy]ethoxy]-1,2-diphenylethoxy]ethoxy]-1,2-diphenylethyl]benzene (PubChem CID 101271686) has the molecular formula C60H58O6 and a molecular weight of 875.12 g/mol. Its IUPAC name is 1-methoxy-4-[(1S,2S)-2-[2-[(1S,2S)-2-[2-[(1S,2S)-2-(4-methoxyphenyl)-1,2-diphenylethoxy]ethoxy]-1,2-diphenylethoxy]ethoxy]-1,2-diphenylethyl]benzene.
| Compound Name | 1-methoxy-4-[(1S,2S)-2-[2-[(1S,2S)-2-[2-[(1S,2S)-2-(4-methoxyphenyl)-1,2-diphenylethoxy]ethoxy]-1,2-diphenylethoxy]ethoxy]-1,2-diphenylethyl]benzene |
|---|---|
| PubChem CID | 101271686 |
| Molecular Formula | C60H58O6 |
| Molecular Weight | 875.12 g/mol |
| Exact Mass | 874.42 |
| IUPAC Name | 1-methoxy-4-[(1S,2S)-2-[2-[(1S,2S)-2-[2-[(1S,2S)-2-(4-methoxyphenyl)-1,2-diphenylethoxy]ethoxy]-1,2-diphenylethoxy]ethoxy]-1,2-diphenylethyl]benzene |
| SMILES | COc1ccc(C(c2ccccc2)[C@H](OCCO[C@@H](c2ccccc2)[C@@H](OCCO[C@H](c2ccccc2)[C@@H](c2ccccc2)c2ccc(OC)cc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C60H58O6/c1-61-53-37-33-47(34-38-53)55(45-21-9-3-10-22-45)57(49-25-13-5-14-26-49)63-41-43-65-59(51-29-17-7-18-30-51)60(52-31-19-8-20-32-52)66-44-42-64-58(50-27-15-6-16-28-50)56(46-23-11-4-12-24-46)48-35-39-54(62-2)40-36-48/h3-40,55-60H,41-44H2,1-2H3/t55-,56?,57+,58+,59-,60-/m0/s1 |
| InChIKey | VNPUTLJVOSGYHW-ZSQVUMDKSA-N |
| XLogP | 13.70 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.12 |
| LogP ≤ 5 | 13.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|