C16H23N5O7S — CID 10127196
[(2R,3S,4R,5R)-5-(5-amino-7-methoxy-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate (PubChem CID 10127196) has the molecular formula C16H23N5O7S and a molecular weight of 429.46 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(5-amino-7-methoxy-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate.
| Compound Name | [(2R,3S,4R,5R)-5-(5-amino-7-methoxy-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 10127196 |
| Molecular Formula | C16H23N5O7S |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(5-amino-7-methoxy-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate |
| SMILES | COc1nc(N)nc2c1sc(=O)n2[C@@H]1O[C@H](COC(=O)[C@@H](N)C(C)C)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H23N5O7S/c1-5(2)7(17)14(24)27-4-6-8(22)9(23)13(28-6)21-11-10(29-16(21)25)12(26-3)20-15(18)19-11/h5-9,13,22-23H,4,17H2,1-3H3,(H2,18,19,20)/t6-,7+,8-,9-,13-/m1/s1 |
| InChIKey | QZLXNJRFAARRRB-RSJOEZCFSA-N |
| XLogP | -1.41 |
| TPSA | 185.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |