C15H18NO4P — CID 101272053
dimethyl 7-(2-cyanoethyl)-5,6-dimethyl-7-phosphabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate (PubChem CID 101272053) has the molecular formula C15H18NO4P and a molecular weight of 307.29 g/mol. Its IUPAC name is dimethyl 7-(2-cyanoethyl)-5,6-dimethyl-7-phosphabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate.
| Compound Name | dimethyl 7-(2-cyanoethyl)-5,6-dimethyl-7-phosphabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 101272053 |
| Molecular Formula | C15H18NO4P |
| Molecular Weight | 307.29 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | dimethyl 7-(2-cyanoethyl)-5,6-dimethyl-7-phosphabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2C(C)=C(C)C1P2CCC#N |
| InChI | InChI=1S/C15H18NO4P/c1-8-9(2)13-11(15(18)20-4)10(14(17)19-3)12(8)21(13)7-5-6-16/h12-13H,5,7H2,1-4H3 |
| InChIKey | YQIMHPYLENXZAH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|