C33H75N3O6S3Si3 — CID 101272185
2-[[8,15-bis(2-trimethylsilylethylsulfonyl)-1,8,15-triazacyclohenicos-1-yl]sulfonyl]ethyl-trimethylsilane (PubChem CID 101272185) has the molecular formula C33H75N3O6S3Si3 and a molecular weight of 790.44 g/mol. Its IUPAC name is 2-[[8,15-bis(2-trimethylsilylethylsulfonyl)-1,8,15-triazacyclohenicos-1-yl]sulfonyl]ethyl-trimethylsilane.
| Compound Name | 2-[[8,15-bis(2-trimethylsilylethylsulfonyl)-1,8,15-triazacyclohenicos-1-yl]sulfonyl]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 101272185 |
| Molecular Formula | C33H75N3O6S3Si3 |
| Molecular Weight | 790.44 g/mol |
| Exact Mass | 789.41 |
| IUPAC Name | 2-[[8,15-bis(2-trimethylsilylethylsulfonyl)-1,8,15-triazacyclohenicos-1-yl]sulfonyl]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCS(=O)(=O)N1CCCCCCN(S(=O)(=O)CC[Si](C)(C)C)CCCCCCN(S(=O)(=O)CC[Si](C)(C)C)CCCCCC1 |
| InChI | InChI=1S/C33H75N3O6S3Si3/c1-46(2,3)31-28-43(37,38)34-22-16-10-12-18-24-35(44(39,40)29-32-47(4,5)6)26-20-14-15-21-27-36(25-19-13-11-17-23-34)45(41,42)30-33-48(7,8)9/h10-33H2,1-9H3 |
| InChIKey | MZZDFRUSBGXDRJ-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 112.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.44 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|