C30H36O6SSi — CID 101272642
[(2S,3R,4S,5R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxy-2-phenylsulfanyloxan-3-yl] acetate (PubChem CID 101272642) has the molecular formula C30H36O6SSi and a molecular weight of 552.77 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxy-2-phenylsulfanyloxan-3-yl] acetate.
| Compound Name | [(2S,3R,4S,5R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxy-2-phenylsulfanyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 101272642 |
| Molecular Formula | C30H36O6SSi |
| Molecular Weight | 552.77 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxy-2-phenylsulfanyloxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@H]1Sc1ccccc1 |
| InChI | InChI=1S/C30H36O6SSi/c1-21(31)35-28-27(33)26(32)25(36-29(28)37-22-14-8-5-9-15-22)20-34-38(30(2,3)4,23-16-10-6-11-17-23)24-18-12-7-13-19-24/h5-19,25-29,32-33H,20H2,1-4H3/t25-,26+,27+,28-,29+/m1/s1 |
| InChIKey | PYQPRRLEKKYGKQ-LLQHYSMESA-N |
| XLogP | 3.73 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.77 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|