C34H40N2O10 — CID 101272687
dimethyl 2-(cyclohexylamino)-5-[2-[5-(cyclohexylamino)-3,4-bis(methoxycarbonyl)furan-2-yl]phenyl]furan-3,4-dicarboxylate (PubChem CID 101272687) has the molecular formula C34H40N2O10 and a molecular weight of 636.70 g/mol. Its IUPAC name is dimethyl 2-(cyclohexylamino)-5-[2-[5-(cyclohexylamino)-3,4-bis(methoxycarbonyl)furan-2-yl]phenyl]furan-3,4-dicarboxylate.
| Compound Name | dimethyl 2-(cyclohexylamino)-5-[2-[5-(cyclohexylamino)-3,4-bis(methoxycarbonyl)furan-2-yl]phenyl]furan-3,4-dicarboxylate |
|---|---|
| PubChem CID | 101272687 |
| Molecular Formula | C34H40N2O10 |
| Molecular Weight | 636.70 g/mol |
| Exact Mass | 636.27 |
| IUPAC Name | dimethyl 2-(cyclohexylamino)-5-[2-[5-(cyclohexylamino)-3,4-bis(methoxycarbonyl)furan-2-yl]phenyl]furan-3,4-dicarboxylate |
| SMILES | COC(=O)c1c(NC2CCCCC2)oc(-c2ccccc2-c2oc(NC3CCCCC3)c(C(=O)OC)c2C(=O)OC)c1C(=O)OC |
| InChI | InChI=1S/C34H40N2O10/c1-41-31(37)23-25(33(39)43-3)29(35-19-13-7-5-8-14-19)45-27(23)21-17-11-12-18-22(21)28-24(32(38)42-2)26(34(40)44-4)30(46-28)36-20-15-9-6-10-16-20/h11-12,17-20,35-36H,5-10,13-16H2,1-4H3 |
| InChIKey | YZSUZQZQQSHKKQ-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 155.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.70 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|