C48H42N6O6 — CID 101272846
4-[2-[2-[7-[2-[2-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]ethoxy]ethoxy]naphthalen-2-yl]oxyethoxy]ethoxy]-2,6-dipyridin-2-ylpyridine (PubChem CID 101272846) has the molecular formula C48H42N6O6 and a molecular weight of 798.90 g/mol. Its IUPAC name is 4-[2-[2-[7-[2-[2-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]ethoxy]ethoxy]naphthalen-2-yl]oxyethoxy]ethoxy]-2,6-dipyridin-2-ylpyridine.
| Compound Name | 4-[2-[2-[7-[2-[2-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]ethoxy]ethoxy]naphthalen-2-yl]oxyethoxy]ethoxy]-2,6-dipyridin-2-ylpyridine |
|---|---|
| PubChem CID | 101272846 |
| Molecular Formula | C48H42N6O6 |
| Molecular Weight | 798.90 g/mol |
| Exact Mass | 798.32 |
| IUPAC Name | 4-[2-[2-[7-[2-[2-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]ethoxy]ethoxy]naphthalen-2-yl]oxyethoxy]ethoxy]-2,6-dipyridin-2-ylpyridine |
| SMILES | c1ccc(-c2cc(OCCOCCOc3ccc4ccc(OCCOCCOc5cc(-c6ccccn6)nc(-c6ccccn6)c5)cc4c3)cc(-c3ccccn3)n2)nc1 |
| InChI | InChI=1S/C48H42N6O6/c1-5-17-49-41(9-1)45-31-39(32-46(53-45)42-10-2-6-18-50-42)59-27-23-55-21-25-57-37-15-13-35-14-16-38(30-36(35)29-37)58-26-22-56-24-28-60-40-33-47(43-11-3-7-19-51-43)54-48(34-40)44-12-4-8-20-52-44/h1-20,29-34H,21-28H2 |
| InChIKey | HADLAKMSFXLOJI-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 132.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.90 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|