C14H8S3 — CID 101273245
7,10,13-trithiapentacyclo[9.6.0.02,9.04,8.012,16]heptadeca-1(11),2(9),4(8),5,12(16),14-hexaene (PubChem CID 101273245) has the molecular formula C14H8S3 and a molecular weight of 272.42 g/mol. Its IUPAC name is 7,10,13-trithiapentacyclo[9.6.0.02,9.04,8.012,16]heptadeca-1(11),2(9),4(8),5,12(16),14-hexaene.
| Compound Name | 7,10,13-trithiapentacyclo[9.6.0.02,9.04,8.012,16]heptadeca-1(11),2(9),4(8),5,12(16),14-hexaene |
|---|---|
| PubChem CID | 101273245 |
| Molecular Formula | C14H8S3 |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 271.98 |
| IUPAC Name | 7,10,13-trithiapentacyclo[9.6.0.02,9.04,8.012,16]heptadeca-1(11),2(9),4(8),5,12(16),14-hexaene |
| SMILES | c1cc2c(s1)-c1sc3c(c1C2)Cc1ccsc1-3 |
| InChI | InChI=1S/C14H8S3/c1-3-15-11-7(1)5-9-10-6-8-2-4-16-12(8)14(10)17-13(9)11/h1-4H,5-6H2 |
| InChIKey | VRTCQLMIVARUKB-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |