About tri(propan-2-yl)-[(1S,2R)-2-prop-1-en-2-ylcyclopropyl]oxysilane
tri(propan-2-yl)-[(1S,2R)-2-prop-1-en-2-ylcyclopropyl]oxysilane (PubChem CID 101273266) has the molecular formula C15H30OSi
and a molecular weight of 254.49 g/mol. Its IUPAC name is tri(propan-2-yl)-[(1S,2R)-2-prop-1-en-2-ylcyclopropyl]oxysilane.
Molecular Properties
| Compound Name | tri(propan-2-yl)-[(1S,2R)-2-prop-1-en-2-ylcyclopropyl]oxysilane |
| PubChem CID | 101273266 |
| Molecular Formula | C15H30OSi |
| Molecular Weight | 254.49 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | tri(propan-2-yl)-[(1S,2R)-2-prop-1-en-2-ylcyclopropyl]oxysilane |
| SMILES | C=C(C)[C@H]1C[C@@H]1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C15H30OSi/c1-10(2)14-9-15(14)16-17(11(3)4,12(5)6)13(7)8/h11-15H,1,9H2,2-8H3/t14-,15+/m1/s1 |
| InChIKey | YENVLTHRWCRQCC-CABCVRRESA-N |
| XLogP | 5.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.49 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tri(propan-2-yl)-[(1S,2R)-2-prop-1-en-2-ylcyclopropyl]oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tri(propan-2-yl)-[(1S,2R)-2-prop-1-en-2-ylcyclopropyl]oxysilane?
The IUPAC name of tri(propan-2-yl)-[(1S,2R)-2-prop-1-en-2-ylcyclopropyl]oxysilane (CID 101273266) is tri(propan-2-yl)-[(1S,2R)-2-prop-1-en-2-ylcyclopropyl]oxysilane.
What is the SMILES notation for tri(propan-2-yl)-[(1S,2R)-2-prop-1-en-2-ylcyclopropyl]oxysilane?
The canonical SMILES for tri(propan-2-yl)-[(1S,2R)-2-prop-1-en-2-ylcyclopropyl]oxysilane is C=C(C)[C@H]1C[C@@H]1O[Si](C(C)C)(C(C)C)C(C)C.
What is the InChIKey of tri(propan-2-yl)-[(1S,2R)-2-prop-1-en-2-ylcyclopropyl]oxysilane?
The InChIKey is YENVLTHRWCRQCC-CABCVRRESA-N. The full InChI is InChI=1S/C15H30OSi/c1-10(2)14-9-15(14)16-17(11(3)4,12(5)6)13(7)8/h11-15H,1,9H2,2-8H3/t14-,15+/m1/s1.
What are the key properties of tri(propan-2-yl)-[(1S,2R)-2-prop-1-en-2-ylcyclopropyl]oxysilane?
tri(propan-2-yl)-[(1S,2R)-2-prop-1-en-2-ylcyclopropyl]oxysilane has a molecular weight of 254.49 g/mol, XLogP of 5.14, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tri(propan-2-yl)-[(1S,2R)-2-prop-1-en-2-ylcyclopropyl]oxysilane is sourced from PubChem (CID 101273266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).