C18H18N2O — CID 101273350
N,4-dibenzyl-N-methyl-1,3-oxazol-2-amine (PubChem CID 101273350) has the molecular formula C18H18N2O and a molecular weight of 278.36 g/mol. Its IUPAC name is N,4-dibenzyl-N-methyl-1,3-oxazol-2-amine.
| Compound Name | N,4-dibenzyl-N-methyl-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 101273350 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | N,4-dibenzyl-N-methyl-1,3-oxazol-2-amine |
| SMILES | CN(Cc1ccccc1)c1nc(Cc2ccccc2)co1 |
| InChI | InChI=1S/C18H18N2O/c1-20(13-16-10-6-3-7-11-16)18-19-17(14-21-18)12-15-8-4-2-5-9-15/h2-11,14H,12-13H2,1H3 |
| InChIKey | XCLYIWHPFOEBKO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |