C18H22Cl2O2 — CID 101273415
4-[2-(2,6-dichloro-3-hydroxyphenyl)ethyl]-7a-methyl-2,3,3a,4,6,7-hexahydro-1H-inden-5-one (PubChem CID 101273415) has the molecular formula C18H22Cl2O2 and a molecular weight of 341.28 g/mol. Its IUPAC name is 4-[2-(2,6-dichloro-3-hydroxyphenyl)ethyl]-7a-methyl-2,3,3a,4,6,7-hexahydro-1H-inden-5-one.
| Compound Name | 4-[2-(2,6-dichloro-3-hydroxyphenyl)ethyl]-7a-methyl-2,3,3a,4,6,7-hexahydro-1H-inden-5-one |
|---|---|
| PubChem CID | 101273415 |
| Molecular Formula | C18H22Cl2O2 |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 4-[2-(2,6-dichloro-3-hydroxyphenyl)ethyl]-7a-methyl-2,3,3a,4,6,7-hexahydro-1H-inden-5-one |
| SMILES | CC12CCCC1C(CCc1c(Cl)ccc(O)c1Cl)C(=O)CC2 |
| InChI | InChI=1S/C18H22Cl2O2/c1-18-9-2-3-13(18)11(15(21)8-10-18)4-5-12-14(19)6-7-16(22)17(12)20/h6-7,11,13,22H,2-5,8-10H2,1H3 |
| InChIKey | MWXKBVDIGDTQNX-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |