C17H26N6O6S — CID 10127402
[(2R,3S,4R,5R)-5-[5-amino-7-(dimethylamino)-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate (PubChem CID 10127402) has the molecular formula C17H26N6O6S and a molecular weight of 442.50 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[5-amino-7-(dimethylamino)-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate.
| Compound Name | [(2R,3S,4R,5R)-5-[5-amino-7-(dimethylamino)-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 10127402 |
| Molecular Formula | C17H26N6O6S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[5-amino-7-(dimethylamino)-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate |
| SMILES | CC(C)[C@H](N)C(=O)OC[C@H]1O[C@@H](n2c(=O)sc3c(N(C)C)nc(N)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H26N6O6S/c1-6(2)8(18)15(26)28-5-7-9(24)10(25)14(29-7)23-13-11(30-17(23)27)12(22(3)4)20-16(19)21-13/h6-10,14,24-25H,5,18H2,1-4H3,(H2,19,20,21)/t7-,8+,9-,10-,14-/m1/s1 |
| InChIKey | DXCMYTXPMJYFNL-AIYANJPJSA-N |
| XLogP | -1.35 |
| TPSA | 179.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |