C23H21N7OS — CID 10127420
4-N-(1H-indazol-5-yl)-2-N-(4-morpholin-4-ylphenyl)thieno[3,2-d]pyrimidine-2,4-diamine (PubChem CID 10127420) has the molecular formula C23H21N7OS and a molecular weight of 443.54 g/mol. Its IUPAC name is 4-N-(1H-indazol-5-yl)-2-N-(4-morpholin-4-ylphenyl)thieno[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(1H-indazol-5-yl)-2-N-(4-morpholin-4-ylphenyl)thieno[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 10127420 |
| Molecular Formula | C23H21N7OS |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 4-N-(1H-indazol-5-yl)-2-N-(4-morpholin-4-ylphenyl)thieno[3,2-d]pyrimidine-2,4-diamine |
| SMILES | c1cc2nc(Nc3ccc(N4CCOCC4)cc3)nc(Nc3ccc4[nH]ncc4c3)c2s1 |
| InChI | InChI=1S/C23H21N7OS/c1-4-18(30-8-10-31-11-9-30)5-2-16(1)26-23-27-20-7-12-32-21(20)22(28-23)25-17-3-6-19-15(13-17)14-24-29-19/h1-7,12-14H,8-11H2,(H,24,29)(H2,25,26,27,28) |
| InChIKey | LPFDOSZJNVVLNZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|