C17H23FO4S — CID 101274531
[(1R,2R,5S)-5-methyl-1-pentyl-6-oxabicyclo[3.1.0]hexan-2-yl] 4-fluorobenzenesulfonate (PubChem CID 101274531) has the molecular formula C17H23FO4S and a molecular weight of 342.43 g/mol. Its IUPAC name is [(1R,2R,5S)-5-methyl-1-pentyl-6-oxabicyclo[3.1.0]hexan-2-yl] 4-fluorobenzenesulfonate.
| Compound Name | [(1R,2R,5S)-5-methyl-1-pentyl-6-oxabicyclo[3.1.0]hexan-2-yl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 101274531 |
| Molecular Formula | C17H23FO4S |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | [(1R,2R,5S)-5-methyl-1-pentyl-6-oxabicyclo[3.1.0]hexan-2-yl] 4-fluorobenzenesulfonate |
| SMILES | CCCCC[C@]12O[C@@]1(C)CC[C@H]2OS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H23FO4S/c1-3-4-5-11-17-15(10-12-16(17,2)22-17)21-23(19,20)14-8-6-13(18)7-9-14/h6-9,15H,3-5,10-12H2,1-2H3/t15-,16+,17-/m1/s1 |
| InChIKey | HROPMCGANTVYBB-IXDOHACOSA-N |
| XLogP | 3.80 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|