C18H17FO4S — CID 101274537
[(1R,2R,5R)-1-methyl-5-phenyl-6-oxabicyclo[3.1.0]hexan-2-yl] 4-fluorobenzenesulfonate (PubChem CID 101274537) has the molecular formula C18H17FO4S and a molecular weight of 348.40 g/mol. Its IUPAC name is [(1R,2R,5R)-1-methyl-5-phenyl-6-oxabicyclo[3.1.0]hexan-2-yl] 4-fluorobenzenesulfonate.
| Compound Name | [(1R,2R,5R)-1-methyl-5-phenyl-6-oxabicyclo[3.1.0]hexan-2-yl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 101274537 |
| Molecular Formula | C18H17FO4S |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | [(1R,2R,5R)-1-methyl-5-phenyl-6-oxabicyclo[3.1.0]hexan-2-yl] 4-fluorobenzenesulfonate |
| SMILES | C[C@]12O[C@@]1(c1ccccc1)CC[C@H]2OS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H17FO4S/c1-17-16(22-24(20,21)15-9-7-14(19)8-10-15)11-12-18(17,23-17)13-5-3-2-4-6-13/h2-10,16H,11-12H2,1H3/t16-,17-,18-/m1/s1 |
| InChIKey | BWRNAVOJNMSAHJ-KZNAEPCWSA-N |
| XLogP | 3.38 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|