C9H14O6 — CID 101276912
dimethyl (E)-4,4-dimethoxypent-2-enedioate (PubChem CID 101276912) has the molecular formula C9H14O6 and a molecular weight of 218.20 g/mol. Its IUPAC name is dimethyl (E)-4,4-dimethoxypent-2-enedioate.
| Compound Name | dimethyl (E)-4,4-dimethoxypent-2-enedioate |
|---|---|
| PubChem CID | 101276912 |
| Molecular Formula | C9H14O6 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | dimethyl (E)-4,4-dimethoxypent-2-enedioate |
| SMILES | COC(=O)/C=C/C(OC)(OC)C(=O)OC |
| InChI | InChI=1S/C9H14O6/c1-12-7(10)5-6-9(14-3,15-4)8(11)13-2/h5-6H,1-4H3/b6-5+ |
| InChIKey | YNMIYPRVILZJAG-AATRIKPKSA-N |
| XLogP | -0.12 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|