C20H28O4 — CID 101277244
(2Z,6E,10E)-2,6,10-trimethyl-13-(5-oxo-2H-furan-3-yl)trideca-2,6,10-trienoic acid (PubChem CID 101277244) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is (2Z,6E,10E)-2,6,10-trimethyl-13-(5-oxo-2H-furan-3-yl)trideca-2,6,10-trienoic acid.
| Compound Name | (2Z,6E,10E)-2,6,10-trimethyl-13-(5-oxo-2H-furan-3-yl)trideca-2,6,10-trienoic acid |
|---|---|
| PubChem CID | 101277244 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (2Z,6E,10E)-2,6,10-trimethyl-13-(5-oxo-2H-furan-3-yl)trideca-2,6,10-trienoic acid |
| SMILES | C/C(=C/CC/C(C)=C/CC/C(C)=C/CCC1=CC(=O)OC1)C(=O)O |
| InChI | InChI=1S/C20H28O4/c1-15(9-5-11-17(3)20(22)23)7-4-8-16(2)10-6-12-18-13-19(21)24-14-18/h7,10-11,13H,4-6,8-9,12,14H2,1-3H3,(H,22,23)/b15-7+,16-10+,17-11- |
| InChIKey | VBZXBFNXHOZDBI-AEPYBEDWSA-N |
| XLogP | 4.73 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|