C19H24O9 — CID 101277299
7-hydroxy-5-methoxy-4-[(Z)-3-methyl-4-[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxybut-2-enyl]-3H-2-benzofuran-1-one (PubChem CID 101277299) has the molecular formula C19H24O9 and a molecular weight of 396.39 g/mol. Its IUPAC name is 7-hydroxy-5-methoxy-4-[(Z)-3-methyl-4-[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxybut-2-enyl]-3H-2-benzofuran-1-one.
| Compound Name | 7-hydroxy-5-methoxy-4-[(Z)-3-methyl-4-[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxybut-2-enyl]-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 101277299 |
| Molecular Formula | C19H24O9 |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 7-hydroxy-5-methoxy-4-[(Z)-3-methyl-4-[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxybut-2-enyl]-3H-2-benzofuran-1-one |
| SMILES | COc1cc(O)c2c(c1C/C=C(/C)CO[C@@H]1OC[C@@H](O)[C@H](O)[C@H]1O)COC2=O |
| InChI | InChI=1S/C19H24O9/c1-9(6-27-19-17(23)16(22)13(21)8-28-19)3-4-10-11-7-26-18(24)15(11)12(20)5-14(10)25-2/h3,5,13,16-17,19-23H,4,6-8H2,1-2H3/b9-3-/t13-,16+,17-,19-/m1/s1 |
| InChIKey | CNPFAHSTHWYNNB-UBJMBKTMSA-N |
| XLogP | 0.02 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|