About 4-[(4-amino-2-chlorophenyl)-chloromethyl]-3,5-dichloroaniline
4-[(4-amino-2-chlorophenyl)-chloromethyl]-3,5-dichloroaniline (PubChem CID 101277520) has the molecular formula C13H10Cl4N2
and a molecular weight of 336.05 g/mol. Its IUPAC name is 4-[(4-amino-2-chlorophenyl)-chloromethyl]-3,5-dichloroaniline.
Molecular Properties
| Compound Name | 4-[(4-amino-2-chlorophenyl)-chloromethyl]-3,5-dichloroaniline |
| PubChem CID | 101277520 |
| Molecular Formula | C13H10Cl4N2 |
| Molecular Weight | 336.05 g/mol |
| Exact Mass | 333.96 |
| IUPAC Name | 4-[(4-amino-2-chlorophenyl)-chloromethyl]-3,5-dichloroaniline |
| SMILES | Nc1ccc(C(Cl)c2c(Cl)cc(N)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H10Cl4N2/c14-9-3-6(18)1-2-8(9)13(17)12-10(15)4-7(19)5-11(12)16/h1-5,13H,18-19H2 |
| InChIKey | JWHXXJLMVINSRL-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.05 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-amino-2-chlorophenyl)-chloromethyl]-3,5-dichloroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-amino-2-chlorophenyl)-chloromethyl]-3,5-dichloroaniline?
The IUPAC name of 4-[(4-amino-2-chlorophenyl)-chloromethyl]-3,5-dichloroaniline (CID 101277520) is 4-[(4-amino-2-chlorophenyl)-chloromethyl]-3,5-dichloroaniline.
What is the SMILES notation for 4-[(4-amino-2-chlorophenyl)-chloromethyl]-3,5-dichloroaniline?
The canonical SMILES for 4-[(4-amino-2-chlorophenyl)-chloromethyl]-3,5-dichloroaniline is Nc1ccc(C(Cl)c2c(Cl)cc(N)cc2Cl)c(Cl)c1.
What is the InChIKey of 4-[(4-amino-2-chlorophenyl)-chloromethyl]-3,5-dichloroaniline?
The InChIKey is JWHXXJLMVINSRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10Cl4N2/c14-9-3-6(18)1-2-8(9)13(17)12-10(15)4-7(19)5-11(12)16/h1-5,13H,18-19H2.
What are the key properties of 4-[(4-amino-2-chlorophenyl)-chloromethyl]-3,5-dichloroaniline?
4-[(4-amino-2-chlorophenyl)-chloromethyl]-3,5-dichloroaniline has a molecular weight of 336.05 g/mol, XLogP of 5.14, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-amino-2-chlorophenyl)-chloromethyl]-3,5-dichloroaniline is sourced from PubChem (CID 101277520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).