C22H42O8 — CID 101278934
bis[2-(2-propoxyethoxy)ethyl] 2,4-dimethylhexanedioate (PubChem CID 101278934) has the molecular formula C22H42O8 and a molecular weight of 434.57 g/mol. Its IUPAC name is bis[2-(2-propoxyethoxy)ethyl] 2,4-dimethylhexanedioate.
| Compound Name | bis[2-(2-propoxyethoxy)ethyl] 2,4-dimethylhexanedioate |
|---|---|
| PubChem CID | 101278934 |
| Molecular Formula | C22H42O8 |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | bis[2-(2-propoxyethoxy)ethyl] 2,4-dimethylhexanedioate |
| SMILES | CCCOCCOCCOC(=O)CC(C)CC(C)C(=O)OCCOCCOCCC |
| InChI | InChI=1S/C22H42O8/c1-5-7-25-9-11-27-13-15-29-21(23)18-19(3)17-20(4)22(24)30-16-14-28-12-10-26-8-6-2/h19-20H,5-18H2,1-4H3 |
| InChIKey | OPXSIVQNZFHVGN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|