C24H26N8O3 — CID 10127905
4-(furan-2-yl)-10-[2-[7-(2-methoxyethoxy)-3,4-dihydro-1H-isoquinolin-2-yl]ethyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine (PubChem CID 10127905) has the molecular formula C24H26N8O3 and a molecular weight of 474.53 g/mol. Its IUPAC name is 4-(furan-2-yl)-10-[2-[7-(2-methoxyethoxy)-3,4-dihydro-1H-isoquinolin-2-yl]ethyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine.
| Compound Name | 4-(furan-2-yl)-10-[2-[7-(2-methoxyethoxy)-3,4-dihydro-1H-isoquinolin-2-yl]ethyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine |
|---|---|
| PubChem CID | 10127905 |
| Molecular Formula | C24H26N8O3 |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 4-(furan-2-yl)-10-[2-[7-(2-methoxyethoxy)-3,4-dihydro-1H-isoquinolin-2-yl]ethyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine |
| SMILES | COCCOc1ccc2c(c1)CN(CCn1ncc3c1nc(N)n1nc(-c4ccco4)nc31)CC2 |
| InChI | InChI=1S/C24H26N8O3/c1-33-11-12-34-18-5-4-16-6-7-30(15-17(16)13-18)8-9-31-22-19(14-26-31)23-27-21(20-3-2-10-35-20)29-32(23)24(25)28-22/h2-5,10,13-14H,6-9,11-12,15H2,1H3,(H2,25,28) |
| InChIKey | UNAZPKBCNPDTAE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|