C22H28O7 — CID 101280239
(1S,2S,6S,7S,9R,13R,17S)-14-(hydroxymethyl)-4,15-dimethoxy-2,6,17-trimethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-4,14-diene-3,11,16-trione (PubChem CID 101280239) has the molecular formula C22H28O7 and a molecular weight of 404.46 g/mol. Its IUPAC name is (1S,2S,6S,7S,9R,13R,17S)-14-(hydroxymethyl)-4,15-dimethoxy-2,6,17-trimethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-4,14-diene-3,11,16-trione.
| Compound Name | (1S,2S,6S,7S,9R,13R,17S)-14-(hydroxymethyl)-4,15-dimethoxy-2,6,17-trimethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-4,14-diene-3,11,16-trione |
|---|---|
| PubChem CID | 101280239 |
| Molecular Formula | C22H28O7 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | (1S,2S,6S,7S,9R,13R,17S)-14-(hydroxymethyl)-4,15-dimethoxy-2,6,17-trimethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-4,14-diene-3,11,16-trione |
| SMILES | COC1=C[C@@H](C)[C@@H]2C[C@H]3OC(=O)C[C@H]4C(CO)=C(OC)C(=O)[C@H]([C@@]2(C)C1=O)[C@@]34C |
| InChI | InChI=1S/C22H28O7/c1-10-6-14(27-4)20(26)22(3)12(10)7-15-21(2)13(8-16(24)29-15)11(9-23)18(28-5)17(25)19(21)22/h6,10,12-13,15,19,23H,7-9H2,1-5H3/t10-,12+,13+,15-,19+,21-,22+/m1/s1 |
| InChIKey | UZHFRKPDXFJESQ-LBTVDEKVSA-N |
| XLogP | 1.79 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |