C23H38O5 — CID 101280928
(4R,5S,6S,7S,9R,11Z,13Z,15S,16R)-7,16-diethyl-4,6-dihydroxy-5,9,13,15-tetramethyl-1-oxacyclohexadeca-11,13-diene-2,10-dione (PubChem CID 101280928) has the molecular formula C23H38O5 and a molecular weight of 394.55 g/mol. Its IUPAC name is (4R,5S,6S,7S,9R,11Z,13Z,15S,16R)-7,16-diethyl-4,6-dihydroxy-5,9,13,15-tetramethyl-1-oxacyclohexadeca-11,13-diene-2,10-dione.
| Compound Name | (4R,5S,6S,7S,9R,11Z,13Z,15S,16R)-7,16-diethyl-4,6-dihydroxy-5,9,13,15-tetramethyl-1-oxacyclohexadeca-11,13-diene-2,10-dione |
|---|---|
| PubChem CID | 101280928 |
| Molecular Formula | C23H38O5 |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | (4R,5S,6S,7S,9R,11Z,13Z,15S,16R)-7,16-diethyl-4,6-dihydroxy-5,9,13,15-tetramethyl-1-oxacyclohexadeca-11,13-diene-2,10-dione |
| SMILES | CC[C@H]1C[C@@H](C)C(=O)/C=C\C(C)=C/[C@H](C)[C@@H](CC)OC(=O)C[C@@H](O)[C@H](C)[C@H]1O |
| InChI | InChI=1S/C23H38O5/c1-7-18-12-15(4)19(24)10-9-14(3)11-16(5)21(8-2)28-22(26)13-20(25)17(6)23(18)27/h9-11,15-18,20-21,23,25,27H,7-8,12-13H2,1-6H3/b10-9-,14-11-/t15-,16+,17+,18+,20-,21-,23-/m1/s1 |
| InChIKey | YJSXTLYNFBFHAT-HIOZYZMFSA-N |
| XLogP | 3.83 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |