About trimethyl-[(1R,5S)-3-methyl-5-trimethylsilyloxycyclohexyl]oxysilane
trimethyl-[(1R,5S)-3-methyl-5-trimethylsilyloxycyclohexyl]oxysilane (PubChem CID 101281703) has the molecular formula C13H30O2Si2
and a molecular weight of 274.55 g/mol. Its IUPAC name is trimethyl-[(1R,5S)-3-methyl-5-trimethylsilyloxycyclohexyl]oxysilane.
Molecular Properties
| Compound Name | trimethyl-[(1R,5S)-3-methyl-5-trimethylsilyloxycyclohexyl]oxysilane |
| PubChem CID | 101281703 |
| Molecular Formula | C13H30O2Si2 |
| Molecular Weight | 274.55 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | trimethyl-[(1R,5S)-3-methyl-5-trimethylsilyloxycyclohexyl]oxysilane |
| SMILES | CC1C[C@@H](O[Si](C)(C)C)C[C@@H](O[Si](C)(C)C)C1 |
| InChI | InChI=1S/C13H30O2Si2/c1-11-8-12(14-16(2,3)4)10-13(9-11)15-17(5,6)7/h11-13H,8-10H2,1-7H3/t11?,12-,13+ |
| InChIKey | LWPDHMIANAWJJP-YHWZYXNKSA-N |
| XLogP | 4.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.55 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[(1R,5S)-3-methyl-5-trimethylsilyloxycyclohexyl]oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[(1R,5S)-3-methyl-5-trimethylsilyloxycyclohexyl]oxysilane?
The IUPAC name of trimethyl-[(1R,5S)-3-methyl-5-trimethylsilyloxycyclohexyl]oxysilane (CID 101281703) is trimethyl-[(1R,5S)-3-methyl-5-trimethylsilyloxycyclohexyl]oxysilane.
What is the SMILES notation for trimethyl-[(1R,5S)-3-methyl-5-trimethylsilyloxycyclohexyl]oxysilane?
The canonical SMILES for trimethyl-[(1R,5S)-3-methyl-5-trimethylsilyloxycyclohexyl]oxysilane is CC1C[C@@H](O[Si](C)(C)C)C[C@@H](O[Si](C)(C)C)C1.
What is the InChIKey of trimethyl-[(1R,5S)-3-methyl-5-trimethylsilyloxycyclohexyl]oxysilane?
The InChIKey is LWPDHMIANAWJJP-YHWZYXNKSA-N. The full InChI is InChI=1S/C13H30O2Si2/c1-11-8-12(14-16(2,3)4)10-13(9-11)15-17(5,6)7/h11-13H,8-10H2,1-7H3/t11?,12-,13+.
What are the key properties of trimethyl-[(1R,5S)-3-methyl-5-trimethylsilyloxycyclohexyl]oxysilane?
trimethyl-[(1R,5S)-3-methyl-5-trimethylsilyloxycyclohexyl]oxysilane has a molecular weight of 274.55 g/mol, XLogP of 4.25, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[(1R,5S)-3-methyl-5-trimethylsilyloxycyclohexyl]oxysilane is sourced from PubChem (CID 101281703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).