C21H24O6 — CID 101282030
(1S,5S,6R,7R,8S)-8-hydroxy-3-methoxy-7-(7-methoxy-1,3-benzodioxol-5-yl)-6-methyl-5-prop-2-enylbicyclo[3.2.1]oct-3-en-2-one (PubChem CID 101282030) has the molecular formula C21H24O6 and a molecular weight of 372.42 g/mol. Its IUPAC name is (1S,5S,6R,7R,8S)-8-hydroxy-3-methoxy-7-(7-methoxy-1,3-benzodioxol-5-yl)-6-methyl-5-prop-2-enylbicyclo[3.2.1]oct-3-en-2-one.
| Compound Name | (1S,5S,6R,7R,8S)-8-hydroxy-3-methoxy-7-(7-methoxy-1,3-benzodioxol-5-yl)-6-methyl-5-prop-2-enylbicyclo[3.2.1]oct-3-en-2-one |
|---|---|
| PubChem CID | 101282030 |
| Molecular Formula | C21H24O6 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | (1S,5S,6R,7R,8S)-8-hydroxy-3-methoxy-7-(7-methoxy-1,3-benzodioxol-5-yl)-6-methyl-5-prop-2-enylbicyclo[3.2.1]oct-3-en-2-one |
| SMILES | C=CC[C@@]12C=C(OC)C(=O)[C@@H]([C@H](c3cc(OC)c4c(c3)OCO4)[C@H]1C)[C@@H]2O |
| InChI | InChI=1S/C21H24O6/c1-5-6-21-9-15(25-4)18(22)17(20(21)23)16(11(21)2)12-7-13(24-3)19-14(8-12)26-10-27-19/h5,7-9,11,16-17,20,23H,1,6,10H2,2-4H3/t11-,16+,17-,20+,21-/m1/s1 |
| InChIKey | UMPAKYGAMCSNNX-RFZQOIHJSA-N |
| XLogP | 2.81 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|