About butyl 3-oxodecanoate
butyl 3-oxodecanoate (PubChem CID 101282177) has the molecular formula C14H26O3
and a molecular weight of 242.36 g/mol. Its IUPAC name is butyl 3-oxodecanoate.
Molecular Properties
| Compound Name | butyl 3-oxodecanoate |
| PubChem CID | 101282177 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | butyl 3-oxodecanoate |
| SMILES | CCCCCCCC(=O)CC(=O)OCCCC |
| InChI | InChI=1S/C14H26O3/c1-3-5-7-8-9-10-13(15)12-14(16)17-11-6-4-2/h3-12H2,1-2H3 |
| InChIKey | UYKBUMKAFBBJJX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze butyl 3-oxodecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 3-oxodecanoate?
The IUPAC name of butyl 3-oxodecanoate (CID 101282177) is butyl 3-oxodecanoate.
What is the SMILES notation for butyl 3-oxodecanoate?
The canonical SMILES for butyl 3-oxodecanoate is CCCCCCCC(=O)CC(=O)OCCCC.
What is the InChIKey of butyl 3-oxodecanoate?
The InChIKey is UYKBUMKAFBBJJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O3/c1-3-5-7-8-9-10-13(15)12-14(16)17-11-6-4-2/h3-12H2,1-2H3.
What are the key properties of butyl 3-oxodecanoate?
butyl 3-oxodecanoate has a molecular weight of 242.36 g/mol, XLogP of 3.65, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 3-oxodecanoate is sourced from PubChem (CID 101282177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).