C19H28O6 — CID 101282317
(3',4,5',6,6',7-hexamethyl-3,8-dioxospiro[2-oxabicyclo[2.2.2]octane-5,2'-oxane]-4'-yl) acetate (PubChem CID 101282317) has the molecular formula C19H28O6 and a molecular weight of 352.43 g/mol. Its IUPAC name is (3',4,5',6,6',7-hexamethyl-3,8-dioxospiro[2-oxabicyclo[2.2.2]octane-5,2'-oxane]-4'-yl) acetate.
| Compound Name | (3',4,5',6,6',7-hexamethyl-3,8-dioxospiro[2-oxabicyclo[2.2.2]octane-5,2'-oxane]-4'-yl) acetate |
|---|---|
| PubChem CID | 101282317 |
| Molecular Formula | C19H28O6 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | (3',4,5',6,6',7-hexamethyl-3,8-dioxospiro[2-oxabicyclo[2.2.2]octane-5,2'-oxane]-4'-yl) acetate |
| SMILES | CC(=O)OC1C(C)C(C)OC2(C(C)C3OC(=O)C2(C)C(=O)C3C)C1C |
| InChI | InChI=1S/C19H28O6/c1-8-12(5)25-19(10(3)14(8)23-13(6)20)11(4)15-9(2)16(21)18(19,7)17(22)24-15/h8-12,14-15H,1-7H3 |
| InChIKey | CMTSHPFXBUQFIX-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|