About Diphenylzinc
Diphenylzinc (PubChem CID 101282607) has the molecular formula C12H10Zn
and a molecular weight of 219.60 g/mol.
Molecular Properties
| Compound Name | Diphenylzinc |
| PubChem CID | 101282607 |
| Molecular Formula | C12H10Zn |
| Molecular Weight | 219.60 g/mol |
| Exact Mass | 218.01 |
| IUPAC Name | — |
| SMILES | [Zn].[c]1ccccc1.[c]1ccccc1 |
| InChI | InChI=1S/2C6H5.Zn/c2*1-2-4-6-5-3-1;/h2*1-5H; |
| InChIKey | MKRVHLWAVKJBFN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.60 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Diphenylzinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Diphenylzinc?
The IUPAC name of Diphenylzinc (CID 101282607) is not available.
What is the SMILES notation for Diphenylzinc?
The canonical SMILES for Diphenylzinc is [Zn].[c]1ccccc1.[c]1ccccc1.
What is the InChIKey of Diphenylzinc?
The InChIKey is MKRVHLWAVKJBFN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H5.Zn/c2*1-2-4-6-5-3-1;/h2*1-5H;.
What are the key properties of Diphenylzinc?
Diphenylzinc has a molecular weight of 219.60 g/mol, XLogP of 2.97, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Diphenylzinc is sourced from PubChem (CID 101282607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).