C15H30NO5+ — CID 101283320
1-carboxyethyl-bis(hydroxymethyl)-[2-[(E)-oct-1-enoxy]ethyl]azanium (PubChem CID 101283320) has the molecular formula C15H30NO5+ and a molecular weight of 304.41 g/mol. Its IUPAC name is 1-carboxyethyl-bis(hydroxymethyl)-[2-[(E)-oct-1-enoxy]ethyl]azanium.
| Compound Name | 1-carboxyethyl-bis(hydroxymethyl)-[2-[(E)-oct-1-enoxy]ethyl]azanium |
|---|---|
| PubChem CID | 101283320 |
| Molecular Formula | C15H30NO5+ |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.21 |
| IUPAC Name | 1-carboxyethyl-bis(hydroxymethyl)-[2-[(E)-oct-1-enoxy]ethyl]azanium |
| SMILES | CCCCCC/C=C/OCC[N+](CO)(CO)C(C)C(=O)O |
| InChI | InChI=1S/C15H29NO5/c1-3-4-5-6-7-8-10-21-11-9-16(12-17,13-18)14(2)15(19)20/h8,10,14,17-18H,3-7,9,11-13H2,1-2H3/p+1/b10-8+ |
| InChIKey | LPUCELAQFUSYIW-CSKARUKUSA-O |
| XLogP | 1.68 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|