C13H22O2 — CID 101283450
[(1E,6E)-4,4-dimethylocta-1,6-dienyl] propanoate (PubChem CID 101283450) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is [(1E,6E)-4,4-dimethylocta-1,6-dienyl] propanoate.
| Compound Name | [(1E,6E)-4,4-dimethylocta-1,6-dienyl] propanoate |
|---|---|
| PubChem CID | 101283450 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | [(1E,6E)-4,4-dimethylocta-1,6-dienyl] propanoate |
| SMILES | C/C=C/CC(C)(C)C/C=C/OC(=O)CC |
| InChI | InChI=1S/C13H22O2/c1-5-7-9-13(3,4)10-8-11-15-12(14)6-2/h5,7-8,11H,6,9-10H2,1-4H3/b7-5+,11-8+ |
| InChIKey | JMXVVYXEXYMFPQ-PAQHSLSSSA-N |
| XLogP | 3.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|